AB-13 (impurity of OK-5101)
Modify Date: 2025-09-16 18:07:53
AB-13 (impurity of OK-5101) structure
|
Common Name | AB-13 (impurity of OK-5101) | ||
|---|---|---|---|---|
| CAS Number | 620633-77-4 | Molecular Weight | 722.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H45F3N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | AB-13 (impurity of OK-5101) |
|---|
| Molecular Formula | C40H45F3N2O7 |
|---|---|
| Molecular Weight | 722.8 |
| InChIKey | XQXUZYJNFBXNMJ-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)C(=C1N=C(c2ccccc2C(F)(F)F)OC(=C(C(=O)OCCOC)c2ccc(C(C)(C)C)cc2)N1)c1ccc(C(C)(C)C)cc1 |