methyl 9,10,12,13-tetrabromooctadecanoate structure
|
Common Name | methyl 9,10,12,13-tetrabromooctadecanoate | ||
|---|---|---|---|---|
| CAS Number | 62080-86-8 | Molecular Weight | 614.08800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H34Br4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 9,10,12,13-tetrabromooctadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H34Br4O2 |
|---|---|
| Molecular Weight | 614.08800 |
| Exact Mass | 609.92900 |
| PSA | 26.30000 |
| LogP | 7.91450 |
| InChIKey | SPUDSROCBBPFEH-UHFFFAOYSA-N |
| SMILES | CCCCCC(Br)C(Br)CC(Br)C(Br)CCCCCCCC(=O)OC |
|
~%
methyl 9,10,12,... CAS#:62080-86-8 |
| Literature: Howton et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 4970,4973 |
|
~%
methyl 9,10,12,... CAS#:62080-86-8 |
| Literature: Palmer; Wright J.ind.eng.Chem., 1914 , vol. 6, p. 822 |
| Octadecanoic acid,9,10,12,13-tetrabromo-,methyl ester |