1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene
![1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene Structure](https://image.chemsrc.com/caspic/451/62084-35-9.png)
1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene structure
|
Common Name | 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 62084-35-9 | Molecular Weight | 419.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H20Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H20Cl2O |
|---|---|
| Molecular Weight | 419.34200 |
| Exact Mass | 418.08900 |
| PSA | 9.23000 |
| LogP | 7.88900 |
| InChIKey | QOOXFDNFHZHMET-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(OC(c2ccccc2)c2ccc(Cl)cc2)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-chloro-4-[[(4... CAS#:62084-35-9
Learn More
|
| Literature: Han, Feng; Yang, Lei; Li, Zhen; Xia, Chungu Advanced Synthesis and Catalysis, 2012 , vol. 354, # 6 p. 1052 - 1060 |
![N-[(4-chlorophenyl)-phenylmethyl]-4-methylbenzenesulfonamide structure](https://image.chemsrc.com/caspic/375/258277-20-2.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,1,1'-[oxybis(phenylmethylene)]bis[4-chloro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: The English name of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene. |
| Q: What is the molecular formula of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: Molecular formula of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is C26H20Cl2O. |
| Q: What English synonyms does 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene have? |
| A: English synonyms of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene: Benzene,1,1'-[oxybis(phenylmethylene)]bis[4-chloro. |
| Q: What is the InChIKey of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: InChIKey of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is QOOXFDNFHZHMET-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: Polar surface area (PSA) of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is 9.23000. |
| Q: What is the Chinese name of 62084-35-9? |
| A: Chinese name of 62084-35-9 is 62084-35-9. |
| Q: What is the LogP of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: LogP of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is 7.88900. |
| Q: What is the molecular weight of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: Molecular weight of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is 419.34200. |
| Q: What is the CAS number of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: CAS number of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is 62084-35-9. |
| Q: What is the SMILES notation of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene? |
| A: SMILES notation of 1-chloro-4-[[(4-chlorophenyl)-phenylmethoxy]-phenylmethyl]benzene is Clc1ccc(C(OC(c2ccccc2)c2ccc(Cl)cc2)c2ccccc2)cc1. |