perchloric acid,6-phenyl-2,3-dihydro-1H-1,4-diazepine structure
|
Common Name | perchloric acid,6-phenyl-2,3-dihydro-1H-1,4-diazepine | ||
|---|---|---|---|---|
| CAS Number | 62084-97-3 | Molecular Weight | 272.68500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | perchloric acid,6-phenyl-2,3-dihydro-1H-1,4-diazepine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13ClN2O4 |
|---|---|
| Molecular Weight | 272.68500 |
| Exact Mass | 272.05600 |
| PSA | 95.83000 |
| LogP | 1.62220 |
| InChIKey | YFPLLURIGDUQTL-UHFFFAOYSA-N |
| SMILES | C1=NCCNC=C1c1ccccc1.[O-][Cl+3]([O-])([O-])O |
|
~76%
perchloric acid... CAS#:62084-97-3 |
| Literature: Lloyd, Douglas; Reichardt, Christian; Struthers, Margot Liebigs Annalen der Chemie, 1986 , # 8 p. 1368 - 1379 |
|
~%
perchloric acid... CAS#:62084-97-3 |
| Literature: Lloyd, Douglas; Tucker, Kanwaljit S.; Marshall, Donald R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 726 - 735 |
| 1H-1,4-Diazepine,2,3-dihydro-6-phenyl-,monoperchlorate |