6-(4-methylphenyl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine structure
|
Common Name | 6-(4-methylphenyl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 62096-69-9 | Molecular Weight | 286.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-methylphenyl)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H14N2O |
|---|---|
| Molecular Weight | 286.32700 |
| Exact Mass | 286.11100 |
| PSA | 38.92000 |
| LogP | 4.86520 |
| InChIKey | IKMQLDOBIJHGGH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccc3c(-c4ccccc4)noc3n2)cc1 |
|
~%
6-(4-methylphen... CAS#:62096-69-9 |
| Literature: Nishiwaki,T. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3339 - 3340 |
| 3-phenyl-6-p-tolyl-isoxazolo[5,4-b]pyridine |
| Isoxazolo[5,4-b]pyridine,6-(4-methylphenyl)-3-phenyl |