6-(4-methoxyphenyl)-5-methyl-3-phenyl-[1,2]oxazolo[5,4-b]pyridine structure
|
Common Name | 6-(4-methoxyphenyl)-5-methyl-3-phenyl-[1,2]oxazolo[5,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 62096-71-3 | Molecular Weight | 316.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-methoxyphenyl)-5-methyl-3-phenyl-[1,2]oxazolo[5,4-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H16N2O2 |
|---|---|
| Molecular Weight | 316.35300 |
| Exact Mass | 316.12100 |
| PSA | 48.15000 |
| LogP | 4.87380 |
| InChIKey | OUDLPHMBTKJHSW-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc3onc(-c4ccccc4)c3cc2C)cc1 |
|
~%
6-(4-methoxyphe... CAS#:62096-71-3 |
| Literature: Nishiwaki,T. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3339 - 3340 |
| 6-(4-methoxy-phenyl)-5-methyl-3-phenyl-isoxazolo[5,4-b]pyridine |
| Isoxazolo[5,4-b]pyridine,6-(4-methoxyphenyl)-5-methyl-3-phenyl |