2(3H)-Furanone,4-(3,4-dimethoxybenzoyl)dihydro- structure
|
Common Name | 2(3H)-Furanone,4-(3,4-dimethoxybenzoyl)dihydro- | ||
|---|---|---|---|---|
| CAS Number | 62096-81-5 | Molecular Weight | 250.24700 | |
| Density | 1.243g/cm3 | Boiling Point | 450.8ºC at 760 mmHg | |
| Molecular Formula | C13H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.6ºC | |
| Name | 4-(3,4-dimethoxybenzoyl)oxolan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 450.8ºC at 760 mmHg |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.24700 |
| Flash Point | 269.6ºC |
| Exact Mass | 250.08400 |
| PSA | 61.83000 |
| LogP | 1.44960 |
| Index of Refraction | 1.54 |
| InChIKey | MKWYWISNPJGVLR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C2COC(=O)C2)cc1OC |
| HS Code | 2932209090 |
|---|
|
~%
2(3H)-Furanone,... CAS#:62096-81-5 |
| Literature: Rothe; Zimmer Journal of Organic Chemistry, 1959 , vol. 24, p. 586,588 |
|
~%
2(3H)-Furanone,... CAS#:62096-81-5 |
| Literature: Rothe; Zimmer Journal of Organic Chemistry, 1959 , vol. 24, p. 586,588 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-veratroyl-dihydro-furan-2-one |
| 4-Veratroyl-dihydro-furan-2-on |