2-chloro-1-cyclohexyl-4-nitrobenzene structure
|
Common Name | 2-chloro-1-cyclohexyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 62115-75-7 | Molecular Weight | 239.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-1-cyclohexyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14ClNO2 |
|---|---|
| Molecular Weight | 239.69800 |
| Exact Mass | 239.07100 |
| PSA | 45.82000 |
| LogP | 4.81910 |
| InChIKey | WDXQOQMLOUYDCL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2CCCCC2)c(Cl)c1 |
|
~%
2-chloro-1-cycl... CAS#:62115-75-7 |
| Literature: Pichat; Beaucourt; Herbert; et al. Journal of Labelled Compounds and Radiopharmaceuticals, 1976 , vol. 12, # 4 p. 483 - 489 |
| Benzene,2-chloro-1-cyclohexyl-4-nitro |