(S)-2-Benzyloxycarbonylamino-pentanedioic acid 5-benzyl ester; compound with dicyclohexyl-amine structure
|
Common Name | (S)-2-Benzyloxycarbonylamino-pentanedioic acid 5-benzyl ester; compound with dicyclohexyl-amine | ||
|---|---|---|---|---|
| CAS Number | 62121-03-3 | Molecular Weight | 552.70200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H44N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-2-Benzyloxycarbonylamino-pentanedioic acid 5-benzyl ester; compound with dicyclohexyl-amine |
|---|
| Molecular Formula | C32H44N2O6 |
|---|---|
| Molecular Weight | 552.70200 |
| Exact Mass | 552.32000 |
| PSA | 113.96000 |
| LogP | 6.91280 |
| InChIKey | KDJQPMAKFIEZHI-LMOVPXPDSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=C(CCC(NC(=O)OCc1ccccc1)C(=O)O)OCc1ccccc1 |