2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline
2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline structure
|
Common Name | 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 62159-30-2 | Molecular Weight | 237.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10F3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10F3NOS |
|---|---|
| Molecular Weight | 237.24200 |
| Exact Mass | 237.04400 |
| PSA | 62.30000 |
| LogP | 3.61300 |
| InChIKey | SWBBXKASFTWWHM-UHFFFAOYSA-N |
| SMILES | CS(=O)Cc1cc(C(F)(F)F)ccc1N |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(methylsulfin... CAS#:62159-30-2 |
| Literature: Sandoz, Inc. Patent: US4006183 A1, 1977 ; |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenamine,2-[(methylsulfinyl)methyl]-4-(trifluoromethyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline have? |
| A: English synonyms of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline: Benzenamine,2-[(methylsulfinyl)methyl]-4-(trifluoromethyl). |
| Q: What is the LogP of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: LogP of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is 3.61300. |
| Q: What is the molecular weight of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: Molecular weight of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is 237.24200. |
| Q: What is the InChIKey of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: InChIKey of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is SWBBXKASFTWWHM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: SMILES notation of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is CS(=O)Cc1cc(C(F)(F)F)ccc1N. |
| Q: What is the English name of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: The English name of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline. |
| Q: What is the CAS number of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: CAS number of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is 62159-30-2. |
| Q: What is the polar surface area (PSA) of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: Polar surface area (PSA) of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is 62.30000. |
| Q: What is the molecular formula of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline? |
| A: Molecular formula of 2-(methylsulfinylmethyl)-4-(trifluoromethyl)aniline is C9H10F3NOS. |
| Q: What is the Chinese name of 62159-30-2? |
| A: Chinese name of 62159-30-2 is 62159-30-2. |