4-((3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)amino)-4-oxobutanoic acid
![4-((3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)amino)-4-oxobutanoic acid Structure](https://image.chemsrc.com/caspic/441/62159-41-5.png)
4-((3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)amino)-4-oxobutanoic acid structure
|
Common Name | 4-((3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)amino)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 62159-41-5 | Molecular Weight | 325.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19NO5S |
|---|---|
| Molecular Weight | 325.38000 |
| Exact Mass | 325.09800 |
| PSA | 120.94000 |
| LogP | 2.67990 |
| InChIKey | PJLKFDHWTSQMKX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(NC(=O)CCC(=O)O)sc2c1CCCC2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![3-(4-OXO-3,4,5,6,7,8-HEXAHYDRO-BENZO[4,5]THIENO[2,3-D]PYRIMIDIN-2-YL)-PROPIONIC ACID structure](https://image.chemsrc.com/caspic/142/109164-47-8.png)
CAS#:109164-47-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(3-ethoxycarbonyl-4,5,6,7-tetrahydro-benzo[b]thiophen-2-yl)-succinamic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: InChIKey of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is PJLKFDHWTSQMKX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: Molecular formula of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is C15H19NO5S. |
| Q: What is the LogP of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: LogP of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is 2.67990. |
| Q: What is the molecular weight of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: Molecular weight of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is 325.38000. |
| Q: What is the English name of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: The English name of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid. |
| Q: What is the Chinese name of 62159-41-5? |
| A: Chinese name of 62159-41-5 is 62159-41-5. |
| Q: What are the downstream products of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: Related downstream products(CAS) of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid: 109164-47-8. |
| Q: What is the SMILES notation of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: SMILES notation of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is CCOC(=O)c1c(NC(=O)CCC(=O)O)sc2c1CCCC2. |
| Q: What is the polar surface area (PSA) of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: Polar surface area (PSA) of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is 120.94000. |
| Q: What is the CAS number of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid? |
| A: CAS number of 4-{[3-(ethoxycarbonyl)-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl]amino}-4-oxobutanoic acid is 62159-41-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |