benzene-1,3,5-triol,benzoic acid
benzene-1,3,5-triol,benzoic acid structure
|
Common Name | benzene-1,3,5-triol,benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 62191-56-4 | Molecular Weight | 248.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Benzene-1,3,5-triol,benzoic acid (CAS number: 62191-56-4, molecular formula: C13H12O5, molecular weight: 248.23100), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzene-1,3,5-triol,benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12O5 |
|---|---|
| Molecular Weight | 248.23100 |
| Exact Mass | 248.06800 |
| PSA | 97.99000 |
| LogP | 2.18820 |
| InChIKey | FPQCHXOADRUKSB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1.Oc1cc(O)cc(O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Benzoyloxy-resorcin |
| benzoic acid 3,5-dihydroxyphenyl ester |
| 3,5-dihydroxyphenyl benzoate |
| 1,3,5-Benzenetriol,monobenzoate |
| 3,5-dihydroxylphenyl benzoate |
| Phloroglucin-monobenzoat |
| 5-benzoyloxy-resorcinol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzene-1,3,5-triol,benzoic acid? |
| A: CAS number of benzene-1,3,5-triol,benzoic acid is 62191-56-4. |
| Q: What is the InChIKey of benzene-1,3,5-triol,benzoic acid? |
| A: InChIKey of benzene-1,3,5-triol,benzoic acid is FPQCHXOADRUKSB-UHFFFAOYSA-N. |
| Q: What English synonyms does benzene-1,3,5-triol,benzoic acid have? |
| A: English synonyms of benzene-1,3,5-triol,benzoic acid: 5-Benzoyloxy-resorcin, benzoic acid 3,5-dihydroxyphenyl ester, 3,5-dihydroxyphenyl benzoate, 1,3,5-Benzenetriol,monobenzoate, 3,5-dihydroxylphenyl benzoate, Phloroglucin-monobenzoat, 5-benzoyloxy-resorcinol. |
| Q: What is the molecular formula of benzene-1,3,5-triol,benzoic acid? |
| A: Molecular formula of benzene-1,3,5-triol,benzoic acid is C13H12O5. |
| Q: What is the LogP of benzene-1,3,5-triol,benzoic acid? |
| A: LogP of benzene-1,3,5-triol,benzoic acid is 2.18820. |
| Q: What is the English name of benzene-1,3,5-triol,benzoic acid? |
| A: The English name of benzene-1,3,5-triol,benzoic acid is benzene-1,3,5-triol,benzoic acid. |
| Q: What is the Chinese name of 62191-56-4? |
| A: Chinese name of 62191-56-4 is 62191-56-4. |
| Q: What is the polar surface area (PSA) of benzene-1,3,5-triol,benzoic acid? |
| A: Polar surface area (PSA) of benzene-1,3,5-triol,benzoic acid is 97.99000. |
| Q: What is the SMILES notation of benzene-1,3,5-triol,benzoic acid? |
| A: SMILES notation of benzene-1,3,5-triol,benzoic acid is O=C(O)c1ccccc1.Oc1cc(O)cc(O)c1. |
| Q: What is the molecular weight of benzene-1,3,5-triol,benzoic acid? |
| A: Molecular weight of benzene-1,3,5-triol,benzoic acid is 248.23100. |