6-hydroxy-5-oxo-3-phenylcyclohepta-1,3,6-triene-1-carbonitrile structure
|
Common Name | 6-hydroxy-5-oxo-3-phenylcyclohepta-1,3,6-triene-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 62215-13-8 | Molecular Weight | 223.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-hydroxy-5-oxo-3-phenylcyclohepta-1,3,6-triene-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9NO2 |
|---|---|
| Molecular Weight | 223.22700 |
| Exact Mass | 223.06300 |
| PSA | 61.09000 |
| LogP | 2.29108 |
| InChIKey | ROHXGGXUSZJNIV-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(-c2ccccc2)cc(=O)c(O)c1 |
|
~%
6-hydroxy-5-oxo... CAS#:62215-13-8 |
| Literature: Dennis,N. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2329 - 2334 |
| 1,3,6-Cycloheptatriene-1-carbonitrile,6-hydroxy-5-oxo-3-phenyl |
| 4-Cyano-6-phenyltropolon |