propan-2-yl bis(2,2,2-trichloroethyl) phosphate structure
|
Common Name | propan-2-yl bis(2,2,2-trichloroethyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 62217-76-9 | Molecular Weight | 402.85200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11Cl6O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | propan-2-yl bis(2,2,2-trichloroethyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H11Cl6O4P |
|---|---|
| Molecular Weight | 402.85200 |
| Exact Mass | 399.85300 |
| PSA | 54.57000 |
| LogP | 5.29310 |
| InChIKey | MWLWHBXQICLYHZ-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=O)(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
|
~%
propan-2-yl bis... CAS#:62217-76-9 |
| Literature: Ogilvie,K.K. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 1277 - 1278 |
| Phosphoric acid,1-methylethyl bis(2,2,2-trichloroethyl) ester |
| Bis(trichlorethyl)isopropylphosphat |
| phosphoric acid isopropyl ester bis-(2,2,2-trichloro-ethyl) ester |