[1,1-Biphenyl]-2,2-diol,5,5-diethyl-(9CI) structure
|
Common Name | [1,1-Biphenyl]-2,2-diol,5,5-diethyl-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 62224-31-1 | Molecular Weight | 242.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethyl-2-(5-ethyl-2-hydroxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18O2 |
|---|---|
| Molecular Weight | 242.31300 |
| Exact Mass | 242.13100 |
| PSA | 40.46000 |
| LogP | 3.88960 |
| InChIKey | QGJCWCMSQVYVIZ-UHFFFAOYSA-N |
| SMILES | CCc1ccc(O)c(-c2cc(CC)ccc2O)c1 |
| HS Code | 2907299090 |
|---|
|
~%
[1,1-Biphenyl]-... CAS#:62224-31-1 |
| Literature: Ono Helvetica Chimica Acta, 1927 , vol. 10, p. 46,47, 51 |
|
~%
[1,1-Biphenyl]-... CAS#:62224-31-1 |
| Literature: Ono Helvetica Chimica Acta, 1927 , vol. 10, p. 46,47, 51 |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| [1,1'-Biphenyl]-2,2'-diol,5,5'-diethyl |
| 5,5'-diethyl-biphenyl-2,2'-diol |
| 5,5'-Diaethyl-biphenyl-2,2'-diol |
| 6.6'-Dioxy-3.3'-diaethyl-diphenyl |
| 5,5'-diethyl-(1,1'-biphenyl)-2,2'-diol |