[[(3,4-diphenyl-1,2-oxazol-5-yl)-phenylmethylidene]amino]urea structure
|
Common Name | [[(3,4-diphenyl-1,2-oxazol-5-yl)-phenylmethylidene]amino]urea | ||
|---|---|---|---|---|
| CAS Number | 62224-84-4 | Molecular Weight | 382.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[(3,4-diphenyl-1,2-oxazol-5-yl)-phenylmethylidene]amino]urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H18N4O2 |
|---|---|
| Molecular Weight | 382.41500 |
| Exact Mass | 382.14300 |
| PSA | 94.50000 |
| LogP | 5.33400 |
| InChIKey | IDCCBJDOQGDIBA-NJNXFGOHSA-N |
| SMILES | NC(=O)NN=C(c1ccccc1)c1onc(-c2ccccc2)c1-c1ccccc1 |
|
~%
[[(3,4-diphenyl... CAS#:62224-84-4 |
| Literature: Jones,R.A.Y.; Sadighi,N. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2259 - 2264 |
| (3,4-diphenyl-isoxazol-5-yl)-phenyl-methanone semicarbazone |
| Hydrazinecarboxamide,2-[(3,4-diphenyl-5-isoxazolyl)phenylmethylene] |
| 5-Benzoyl-3,4-diphenylisoxazol-semicarbazon |