Diethyl 2,3-dichlorobutanedioate
Modify Date: 2025-08-25 13:35:02
Diethyl 2,3-dichlorobutanedioate structure
|
Common Name | Diethyl 2,3-dichlorobutanedioate | ||
|---|---|---|---|---|
| CAS Number | 62243-26-9 | Molecular Weight | 243.08400 | |
| Density | 1.272g/cm3 | Boiling Point | 116ºC/400Pa | |
| Molecular Formula | C8H12Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.5ºC | |
| Name | Diethyl 2,3-dichlorobutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 116ºC/400Pa |
| Molecular Formula | C8H12Cl2O4 |
| Molecular Weight | 243.08400 |
| Flash Point | 113.5ºC |
| Exact Mass | 242.01100 |
| PSA | 52.60000 |
| LogP | 1.32740 |
| Index of Refraction | 1.459 |
| InChIKey | PBGMSGHICSEALQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)C(Cl)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3-Dichlor-bernsteinsaeure-diaethylester |
| 2,3-dichloro-succinic acid diethyl ester |
| Diethyl 2,3-dichloro succinate |