2-bromo-1-(6-methylsulfanylnaphthalen-2-yl)ethanone structure
|
Common Name | 2-bromo-1-(6-methylsulfanylnaphthalen-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 62244-83-1 | Molecular Weight | 295.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BrOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-1-(6-methylsulfanylnaphthalen-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11BrOS |
|---|---|
| Molecular Weight | 295.19500 |
| Exact Mass | 293.97100 |
| PSA | 42.37000 |
| LogP | 4.13930 |
| InChIKey | LKZLFHXHDRHUAU-UHFFFAOYSA-N |
| SMILES | CSc1ccc2cc(C(=O)CBr)ccc2c1 |
|
~71%
2-bromo-1-(6-me... CAS#:62244-83-1 |
| Literature: Thirunarayanan; Vanangamudi; Sathiyendran; Ravi Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2011 , vol. 50, # 4 p. 593 - 604 |
|
~%
2-bromo-1-(6-me... CAS#:62244-83-1 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1953 , p. 485,486, 488 |
| Ethanone,2-bromo-1-[6-(methylthio)-2-naphthalenyl] |
| 2-bromo-1-(6-methylsulfanyl-[2]naphthyl)-ethanone |
| 6-Methylthio-2-(bromacetyl)-naphthalin |
| 2-Brom-1-(6-methylmercapto-[2]naphthyl)-aethanon |
| andw-Brom-6-methylthio-2-acetonaphthon |