4-chloro-3-ethoxy-7-nitroisochromen-1-one
4-chloro-3-ethoxy-7-nitroisochromen-1-one structure
|
Common Name | 4-chloro-3-ethoxy-7-nitroisochromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 62252-29-3 | Molecular Weight | 269.63800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-3-ethoxy-7-nitroisochromen-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8ClNO5 |
|---|---|
| Molecular Weight | 269.63800 |
| Exact Mass | 269.00900 |
| PSA | 85.26000 |
| LogP | 3.27650 |
| InChIKey | GHFHDXKEIJJCFT-UHFFFAOYSA-N |
| SMILES | CCOc1oc(=O)c2cc([N+](=O)[O-])ccc2c1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of gamma-secretase-mediated betaAPP K670N/M671L mutant cleavage in HEK293 ...
Source: ChEMBL
Target: Gamma-secretase subunit APH-1B
External Id: CHEMBL2344497
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-nitro-3-ethoxy-4-chloroisocoumarin |
| 4-Chlor-3-aethoxy-7-nitroisocumarin |
| 1H-2-Benzopyran-1-one,4-chloro-3-ethoxy-7-nitro |
| 4-chloro-3-ethoxy-7-nitroisocoumarin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: Polar surface area (PSA) of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is 85.26000. |
| Q: What is the InChIKey of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: InChIKey of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is GHFHDXKEIJJCFT-UHFFFAOYSA-N. |
| Q: What is the English name of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: The English name of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is 4-chloro-3-ethoxy-7-nitroisochromen-1-one. |
| Q: What is the CAS number of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: CAS number of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is 62252-29-3. |
| Q: What is the LogP of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: LogP of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is 3.27650. |
| Q: What is the molecular weight of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: Molecular weight of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is 269.63800. |
| Q: What is the Chinese name of 62252-29-3? |
| A: Chinese name of 62252-29-3 is 62252-29-3. |
| Q: What is the SMILES notation of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: SMILES notation of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is CCOc1oc(=O)c2cc([N+](=O)[O-])ccc2c1Cl. |
| Q: What is the molecular formula of 4-chloro-3-ethoxy-7-nitroisochromen-1-one? |
| A: Molecular formula of 4-chloro-3-ethoxy-7-nitroisochromen-1-one is C11H8ClNO5. |
| Q: What English synonyms does 4-chloro-3-ethoxy-7-nitroisochromen-1-one have? |
| A: English synonyms of 4-chloro-3-ethoxy-7-nitroisochromen-1-one: 7-nitro-3-ethoxy-4-chloroisocoumarin, 4-Chlor-3-aethoxy-7-nitroisocumarin, 1H-2-Benzopyran-1-one,4-chloro-3-ethoxy-7-nitro, 4-chloro-3-ethoxy-7-nitroisocoumarin. |