ethyl N-nitro-N-propan-2-yl-carbamate structure
|
Common Name | ethyl N-nitro-N-propan-2-yl-carbamate | ||
|---|---|---|---|---|
| CAS Number | 62261-05-6 | Molecular Weight | 176.17000 | |
| Density | 1.163g/cm3 | Boiling Point | 230.6ºC at 760 mmHg | |
| Molecular Formula | C6H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.2ºC | |
| Name | ethyl N-nitro-N-propan-2-ylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 230.6ºC at 760 mmHg |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17000 |
| Flash Point | 93.2ºC |
| Exact Mass | 176.08000 |
| PSA | 75.36000 |
| LogP | 1.56820 |
| Index of Refraction | 1.457 |
| InChIKey | GAGGRUKAQFFMBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(C(C)C)[N+](=O)[O-] |
|
~%
ethyl N-nitro-N... CAS#:62261-05-6 |
| Literature: Curry; Mason Journal of the American Chemical Society, 1951 , vol. 73, p. 5043,5044 Journal of the American Chemical Society, 1953 , vol. 75, p. 6357 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Isopropyl-nitro-carbamidsaeure-aethylester |
| isopropyl-nitro-carbamic acid ethyl ester |