4-methyl-4-phenyl-2-(trifluoromethyl)-1,3-oxazol-5-one structure
|
Common Name | 4-methyl-4-phenyl-2-(trifluoromethyl)-1,3-oxazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 62263-54-1 | Molecular Weight | 243.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-4-phenyl-2-(trifluoromethyl)-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8F3NO2 |
|---|---|
| Molecular Weight | 243.18200 |
| Exact Mass | 243.05100 |
| PSA | 38.66000 |
| LogP | 1.85500 |
| InChIKey | FJOFEYKTNUADFQ-UHFFFAOYSA-N |
| SMILES | CC1(c2ccccc2)N=C(C(F)(F)F)OC1=O |
|
~%
4-methyl-4-phen... CAS#:62263-54-1 |
| Literature: Jones,D.S. et al. Journal of the Chemical Society, 1965 , p. 6227 - 6239 |
| 4-methyl-4-phenyl-2-trifluoromethyl-4H-oxazol-5-one |
| 5(4H)-Oxazolone,4-methyl-4-phenyl-2-(trifluoromethyl) |
| 2-Trifluormethyl-4-methyl-4-phenyl-oxazolon-(5) |
| DL-2-Trifluormethyl-4-methyl-4-phenyl-oxazolon |