2-(3-methoxypentan-3-yl)-2-trimethylsilyloxycyclobutan-1-one structure
|
Common Name | 2-(3-methoxypentan-3-yl)-2-trimethylsilyloxycyclobutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 62276-31-7 | Molecular Weight | 258.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methoxypentan-3-yl)-2-trimethylsilyloxycyclobutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H26O3Si |
|---|---|
| Molecular Weight | 258.42900 |
| Exact Mass | 258.16500 |
| PSA | 35.53000 |
| LogP | 3.14480 |
| InChIKey | HVXGEQXIAITALD-UHFFFAOYSA-N |
| SMILES | CCC(CC)(OC)C1(O[Si](C)(C)C)CCC1=O |
|
~92%
2-(3-methoxypen... CAS#:62276-31-7 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
| Cyclobutanone,2-(1-ethyl-1-methoxypropyl)-2-[(trimethylsilyl)oxy] |
| 2-(1-ethyl-1-methoxypropyl)-2-(trimethylsiloxy)cyclobutanone |