3-tert-butyl-2,2,4-trimethylhept-5-en-3-ol structure
|
Common Name | 3-tert-butyl-2,2,4-trimethylhept-5-en-3-ol | ||
|---|---|---|---|---|
| CAS Number | 62291-72-9 | Molecular Weight | 212.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-2,2,4-trimethylhept-5-en-3-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H28O |
|---|---|
| Molecular Weight | 212.37200 |
| Exact Mass | 212.21400 |
| PSA | 20.23000 |
| LogP | 4.02190 |
| InChIKey | YCLZBXFJEMNLDZ-UHFFFAOYSA-N |
| SMILES | CC=CC(C)C(O)(C(C)(C)C)C(C)(C)C |
|
~%
3-tert-butyl-2,... CAS#:62291-72-9 |
| Literature: Benkeser,R.A. et al. Journal of the American Chemical Society, 1978 , vol. 100, p. 2134 - 2139 |
| 5-Hepten-3-ol,3-(1,1-dimethylethyl)-2,2,4-trimethyl-,(Z) |
| Di-t-butyl-2-pent-3-enylcarbinol |
| 3-tert-butyl-2,2,4-trimethyl-hept-5-en-3-ol |