ethyl 2-[phenyl(phenylmethoxy)phosphoryl]propanoate structure
|
Common Name | ethyl 2-[phenyl(phenylmethoxy)phosphoryl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 62292-00-6 | Molecular Weight | 332.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[phenyl(phenylmethoxy)phosphoryl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21O4P |
|---|---|
| Molecular Weight | 332.33100 |
| Exact Mass | 332.11800 |
| PSA | 62.41000 |
| LogP | 3.75840 |
| InChIKey | SZBYHNFOXJPHNZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)P(=O)(OCc1ccccc1)c1ccccc1 |
|
~%
ethyl 2-[phenyl... CAS#:62292-00-6 |
| Literature: Brownbridge,P. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2024 - 2034 |
| Propanoic acid,2-[phenyl(phenylmethoxy)phosphinyl]-,ethyl ester |