[phenyl(prop-1-en-2-yloxy)phosphoryl]oxymethylbenzene structure
|
Common Name | [phenyl(prop-1-en-2-yloxy)phosphoryl]oxymethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 62292-08-4 | Molecular Weight | 288.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [phenyl(prop-1-en-2-yloxy)phosphoryl]oxymethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17O3P |
|---|---|
| Molecular Weight | 288.27800 |
| Exact Mass | 288.09200 |
| PSA | 45.34000 |
| LogP | 4.27200 |
| InChIKey | MOGBPKOUUYFNOI-UHFFFAOYSA-N |
| SMILES | C=C(C)OP(=O)(OCc1ccccc1)c1ccccc1 |
|
~%
[phenyl(prop-1-... CAS#:62292-08-4 |
| Literature: Brownbridge,P. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2024 - 2034 |
| Phosphonic acid,phenyl-,1-methylethenyl phenylmethyl ester |
| Phenylphosphonsaeure(benzyl)isopropenylester |