2-[2-(dimethylamino)ethoxycarbonyl]benzoate structure
|
Common Name | 2-[2-(dimethylamino)ethoxycarbonyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 62295-32-3 | Molecular Weight | 236.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14NO4- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(dimethylamino)ethoxycarbonyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14NO4- |
|---|---|
| Molecular Weight | 236.24400 |
| Exact Mass | 236.09200 |
| PSA | 69.67000 |
| InChIKey | BDSIGVLKFSPWRG-UHFFFAOYSA-M |
| SMILES | CN(C)CCOC(=O)c1ccccc1C(=O)[O-] |
|
~%
2-[2-(dimethyla... CAS#:62295-32-3 |
| Literature: Rice et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 3025 |
|
~%
2-[2-(dimethyla... CAS#:62295-32-3 |
| Literature: Eichberger, Guenter; Griengl, Herfried; Paar, Willibald Monatshefte fuer Chemie, 1986 , vol. 117, p. 545 - 552 |
| Phthalsaeure-mono-(2-dimethylamino-aethylester) |
| 1,2-Benzenedicarboxylic acid,mono[2-(dimethylamino)ethyl] ester |
| phthalic acid mono-(2-dimethylamino-ethyl ester) |
| Phthalsaeuremono-(2-dimethylaminoethyl)ester |
| 2-(2-Dimethylamino-ethoxycarbonyl)-benzoesaeure |