2-[1-(2-pyrrolidin-1-ylethyl)pyridin-4-ylidene]indene-1,3-dione structure
|
Common Name | 2-[1-(2-pyrrolidin-1-ylethyl)pyridin-4-ylidene]indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 62295-41-4 | Molecular Weight | 320.38500 | |
| Density | 1.271g/cm3 | Boiling Point | 451.3ºC at 760 mmHg | |
| Molecular Formula | C20H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | 2-[1-(2-pyrrolidin-1-ylethyl)pyridin-4-ylidene]indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 451.3ºC at 760 mmHg |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.38500 |
| Flash Point | 191ºC |
| Exact Mass | 320.15200 |
| PSA | 42.31000 |
| LogP | 2.03280 |
| Index of Refraction | 1.646 |
| InChIKey | RKAKJXWLAISIOY-UHFFFAOYSA-N |
| SMILES | O=C1C(=C2C=CN(CCN3CCCC3)C=C2)C(=O)c2ccccc21 |
|
~49%
2-[1-(2-pyrroli... CAS#:62295-41-4 |
| Literature: Letourneux; Sparfel; Roussakis; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 6 p. 535 - 540 |
| 2-[1-(2-pyrrolidin-1-yl-ethyl)-1H-pyridin-4-ylidene]-indan-1,3-dione |