1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene
1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene structure
|
Common Name | 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene | ||
|---|---|---|---|---|
| CAS Number | 62344-63-2 | Molecular Weight | 220.09900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4F4O4S |
|---|---|
| Molecular Weight | 220.09900 |
| Exact Mass | 219.94500 |
| PSA | 68.82000 |
| LogP | 1.69720 |
| InChIKey | JUDPQMILCPMXOJ-UHFFFAOYSA-N |
| SMILES | O=C1C(F)=C(OS(=O)(=O)F)C1(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,3,3-trifluoro... CAS#:62344-63-2 |
| Literature: Smart,B.E.; Krespan,C.G. Journal of the American Chemical Society, 1977 , vol. 99, p. 1218 - 1221 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Fluorosulfuric acid,2,4,4-trifluoro-3-oxo-1-cyclobuten-1-yl ester |
| 3-Fluorsulfato-2,4,4-trifluorcyclobut-2-en-1-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: The English name of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene. |
| Q: What is the Chinese name of 62344-63-2? |
| A: Chinese name of 62344-63-2 is 62344-63-2. |
| Q: What is the polar surface area (PSA) of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: Polar surface area (PSA) of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is 68.82000. |
| Q: What is the CAS number of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: CAS number of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is 62344-63-2. |
| Q: What is the SMILES notation of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: SMILES notation of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is O=C1C(F)=C(OS(=O)(=O)F)C1(F)F. |
| Q: What is the LogP of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: LogP of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is 1.69720. |
| Q: What is the molecular weight of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: Molecular weight of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is 220.09900. |
| Q: What English synonyms does 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene have? |
| A: English synonyms of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene: Fluorosulfuric acid,2,4,4-trifluoro-3-oxo-1-cyclobuten-1-yl ester, 3-Fluorsulfato-2,4,4-trifluorcyclobut-2-en-1-on. |
| Q: What is the molecular formula of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: Molecular formula of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is C4F4O4S. |
| Q: What is the InChIKey of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene? |
| A: InChIKey of 1,3,3-trifluoro-2-fluorosulfonyloxy-4-oxocyclobutene is JUDPQMILCPMXOJ-UHFFFAOYSA-N. |