2,2,5,5-tetramethyl-3-oxido-1,3-oxazol-3-ium structure
|
Common Name | 2,2,5,5-tetramethyl-3-oxido-1,3-oxazol-3-ium | ||
|---|---|---|---|---|
| CAS Number | 62344-87-0 | Molecular Weight | 143.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,5,5-tetramethyl-3-oxido-1,3-oxazol-3-ium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H13NO2 |
|---|---|
| Molecular Weight | 143.18400 |
| Exact Mass | 143.09500 |
| PSA | 37.98000 |
| LogP | 1.07120 |
| InChIKey | ORCMLNYLCOQOFJ-UHFFFAOYSA-N |
| SMILES | CC1(C)C=[N+]([O-])C(C)(C)O1 |
|
~%
2,2,5,5-tetrame... CAS#:62344-87-0 |
| Literature: Rogic,M.M. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 1156 - 1171 |
| Oxazole,2,5-dihydro-2,2,5,5-tetramethyl-,3-oxide |
| 2,2,5,5-Tetramethyl-3-oxazolin-N-oxid |
| 2,2,5,5-tetramethyl-2,5-dihydro-oxazole 3-oxide |