4-hydroxy-7,8-dimethoxynaphthalene-1,2-dione structure
|
Common Name | 4-hydroxy-7,8-dimethoxynaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 62345-02-2 | Molecular Weight | 234.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-7,8-dimethoxynaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10O5 |
|---|---|
| Molecular Weight | 234.20500 |
| Exact Mass | 234.05300 |
| PSA | 72.83000 |
| LogP | 1.36810 |
| InChIKey | FKGVCYPEBRYQOF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)C(=O)C(=O)C=C2O |
|
~%
4-hydroxy-7,8-d... CAS#:62345-02-2 |
| Literature: Bruce; Thomson Journal of the Chemical Society, 1955 , p. 1089,1093 |
|
~%
4-hydroxy-7,8-d... CAS#:62345-02-2 |
| Literature: Bruce; Thomson Journal of the Chemical Society, 1955 , p. 1089,1093 |
| 2-hydroxy-7,8-dimethoxy-[1,4]naphthoquinone |
| 1,4-Naphthalenedione,2-hydroxy-7,8-dimethoxy |
| 2-Hydroxy-7,8-dimethoxy-1,4-naphthochinon |