1-chloro-4-(tribromo-λ4-selanyl)benzene
1-chloro-4-(tribromo-λ4-selanyl)benzene structure
|
Common Name | 1-chloro-4-(tribromo-λ4-selanyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 62350-87-2 | Molecular Weight | 430.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Br3ClSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-4-(tribromo-λ4-selanyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4Br3ClSe |
|---|---|
| Molecular Weight | 430.22100 |
| Exact Mass | 427.67200 |
| LogP | 3.67060 |
| InChIKey | DUQOBROFUZARGE-UHFFFAOYSA-N |
| SMILES | Clc1ccc([Se](Br)(Br)Br)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-chloro-4-(tri... CAS#:62350-87-2 |
| Literature: Paulmier, Claude; Outurquin, Francis; Plaquevent, Jean-Christophe Tetrahedron Letters, 1988 , vol. 29, # 46 p. 5893 - 5896 |
|
~49%
1-chloro-4-(tri... CAS#:62350-87-2 |
| Literature: Barnes, Nicholas A.; Godfrey, Stephen M.; Ollerenshaw, Ruth T. A.; Khan, Rana Z.; Pritchard, Robin G. Dalton Transactions, 2012 , vol. 41, # 48 p. 14583 - 14593 |
|
~%
1-chloro-4-(tri... CAS#:62350-87-2 |
| Literature: Behaghel; Seibert Chemische Berichte, 1933 , vol. 66, p. 708,716 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Selenium,tribromo(4-chlorophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-chloro-4-(tribromo-λ4-selanyl)benzene? |
| A: Molecular weight of 1-chloro-4-(tribromo-λ4-selanyl)benzene is 430.22100. |
| Q: What is the CAS number of 1-chloro-4-(tribromo-λ4-selanyl)benzene? |
| A: CAS number of 1-chloro-4-(tribromo-λ4-selanyl)benzene is 62350-87-2. |
| Q: What is the SMILES notation of 1-chloro-4-(tribromo-λ4-selanyl)benzene? |
| A: SMILES notation of 1-chloro-4-(tribromo-λ4-selanyl)benzene is Clc1ccc([Se](Br)(Br)Br)cc1. |
| Q: What is the LogP of 1-chloro-4-(tribromo-λ4-selanyl)benzene? |
| A: LogP of 1-chloro-4-(tribromo-λ4-selanyl)benzene is 3.67060. |
| Q: What English synonyms does 1-chloro-4-(tribromo-λ4-selanyl)benzene have? |
| A: English synonyms of 1-chloro-4-(tribromo-λ4-selanyl)benzene: Selenium,tribromo(4-chlorophenyl). |
| Q: What is the InChIKey of 1-chloro-4-(tribromo-λ4-selanyl)benzene? |
| A: InChIKey of 1-chloro-4-(tribromo-λ4-selanyl)benzene is DUQOBROFUZARGE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 62350-87-2? |
| A: Chinese name of 62350-87-2 is 62350-87-2. |
| Q: What is the molecular formula of 1-chloro-4-(tribromo-λ4-selanyl)benzene? |
| A: Molecular formula of 1-chloro-4-(tribromo-λ4-selanyl)benzene is C6H4Br3ClSe. |
| Q: What is the English name of 1-chloro-4-(tribromo-λ4-selanyl)benzene? |
| A: The English name of 1-chloro-4-(tribromo-λ4-selanyl)benzene is 1-chloro-4-(tribromo-λ4-selanyl)benzene. |