2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one
2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one structure
|
Common Name | 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 62353-93-9 | Molecular Weight | 327.37900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H17N3O |
|---|---|
| Molecular Weight | 327.37900 |
| Exact Mass | 327.13700 |
| PSA | 39.82000 |
| LogP | 3.74930 |
| InChIKey | KIMNTWMQBHGGHU-UHFFFAOYSA-N |
| SMILES | O=c1n(Cc2ccccc2)nc(-c2ccccc2)n1-c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~79%
2-benzyl-4,5-di... CAS#:62353-93-9 |
| Literature: Nguyen, Thu-Huong; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 1383 - 1388 |
|
~%
2-benzyl-4,5-di... CAS#:62353-93-9 |
| Literature: Nguyen, Thu-Huong; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 1383 - 1388 |
|
~%
2-benzyl-4,5-di... CAS#:62353-93-9 |
| Literature: Nguyen, Thu-Huong; Milcent, Rene; Barbier, Geo Journal of Heterocyclic Chemistry, 1985 , vol. 22, p. 1383 - 1388 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3H-1,2,4-Triazol-3-one,2,4-dihydro-4,5-diphenyl-2-(phenylmethyl) |
| 2-benzyl-4,5-diphenyl-2,4-dihydro-[1,2,4]triazol-3-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: LogP of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is 3.74930. |
| Q: What is the English name of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: The English name of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one. |
| Q: What is the SMILES notation of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: SMILES notation of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is O=c1n(Cc2ccccc2)nc(-c2ccccc2)n1-c1ccccc1. |
| Q: What is the CAS number of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: CAS number of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is 62353-93-9. |
| Q: What is the molecular weight of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: Molecular weight of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is 327.37900. |
| Q: What is the molecular formula of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: Molecular formula of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is C21H17N3O. |
| Q: What is the InChIKey of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: InChIKey of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is KIMNTWMQBHGGHU-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one have? |
| A: English synonyms of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one: 3H-1,2,4-Triazol-3-one,2,4-dihydro-4,5-diphenyl-2-(phenylmethyl), 2-benzyl-4,5-diphenyl-2,4-dihydro-[1,2,4]triazol-3-one. |
| Q: What is the Chinese name of 62353-93-9? |
| A: Chinese name of 62353-93-9 is 62353-93-9. |
| Q: What is the polar surface area (PSA) of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one? |
| A: Polar surface area (PSA) of 2-benzyl-4,5-diphenyl-1,2,4-triazol-3-one is 39.82000. |