(1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone
![(1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone Structure](https://image.chemsrc.com/caspic/494/62356-33-6.png)
(1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone structure
|
Common Name | (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 62356-33-6 | Molecular Weight | 253.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10F3NO |
|---|---|
| Molecular Weight | 253.22000 |
| Exact Mass | 253.07100 |
| PSA | 22.00000 |
| LogP | 3.27490 |
| InChIKey | LIOKQHCIMNJVSL-UHFFFAOYSA-N |
| SMILES | Cn1ccc(C(=O)c2ccc(C(F)(F)F)cc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(1-methylpyrrol... CAS#:62356-33-6 |
| Literature: Carson, John R.; Davis, Nancy M. Journal of Organic Chemistry, 1981 , vol. 46, # 5 p. 839 - 843 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methanone,(1-methyl-1H-pyrrol-3-yl)[4-(trifluoromethyl)phenyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: Molecular weight of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is 253.22000. |
| Q: What is the molecular formula of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: Molecular formula of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is C13H10F3NO. |
| Q: What is the English name of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: The English name of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone. |
| Q: What is the LogP of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: LogP of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is 3.27490. |
| Q: What is the SMILES notation of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: SMILES notation of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is Cn1ccc(C(=O)c2ccc(C(F)(F)F)cc2)c1. |
| Q: What is the InChIKey of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: InChIKey of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is LIOKQHCIMNJVSL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 62356-33-6? |
| A: Chinese name of 62356-33-6 is 62356-33-6. |
| Q: What English synonyms does (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone have? |
| A: English synonyms of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone: Methanone,(1-methyl-1H-pyrrol-3-yl)[4-(trifluoromethyl)phenyl]. |
| Q: What is the CAS number of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: CAS number of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is 62356-33-6. |
| Q: What is the polar surface area (PSA) of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone? |
| A: Polar surface area (PSA) of (1-methylpyrrol-3-yl)-[4-(trifluoromethyl)phenyl]methanone is 22.00000. |