Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate
Modify Date: 2026-07-03 18:04:39
Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate structure
|
Common Name | Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 623582-55-8 | Molecular Weight | 251.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO4 |
|---|---|
| Molecular Weight | 251.28 |
| InChIKey | XGVLJOOUXLUHSB-NEPJUHHUSA-N |
| SMILES | O=C(NC1COCC1CO)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate? |
| A: Molecular weight of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate is 251.28. |
| Q: What is the InChIKey of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate? |
| A: InChIKey of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate is XGVLJOOUXLUHSB-NEPJUHHUSA-N. |
| Q: What is the SMILES notation of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate? |
| A: SMILES notation of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate is O=C(NC1COCC1CO)OCc1ccccc1. |
| Q: What is the CAS number of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate? |
| A: CAS number of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate is 623582-55-8. |
| Q: What is the Chinese name of 623582-55-8? |
| A: Chinese name of 623582-55-8 is 623582-55-8. |
| Q: What is the molecular formula of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate? |
| A: Molecular formula of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate is C13H17NO4. |
| Q: What is the English name of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate? |
| A: The English name of Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate is Benzyl ((3R,4R)-4-(hydroxymethyl)tetrahydrofuran-3-yl)carbamate. |