Methyl 6-bromoquinoline-2-carboxylate structure
|
Common Name | Methyl 6-bromoquinoline-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 623583-88-0 | Molecular Weight | 266.091 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 374.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.3±22.3 °C | |
| Name | Methyl 6-bromoquinoline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.6±22.0 °C at 760 mmHg |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.091 |
| Flash Point | 180.3±22.3 °C |
| Exact Mass | 264.973846 |
| PSA | 39.19000 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | SKSQECLLCVBRDD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2cc(Br)ccc2n1 |
| HS Code | 2933499090 |
|---|
|
~85%
Methyl 6-bromoq... CAS#:623583-88-0 |
| Literature: SmithKline Beecham Corporation Patent: US2008/96921 A1, 2008 ; Location in patent: Page/Page column 32 ; |
|
~%
Methyl 6-bromoq... CAS#:623583-88-0 |
| Literature: Hulme, Christopher; Ncube, Mghele Vellah; Norman, Mark H.; Ognyanov, Vassil I.; Pettus, Liping H.; Wang, Xianghong; Zhu, Jiawang Patent: US2005/165049 A1, 2005 ; Location in patent: Page/Page column 22 ; US 20050165049 A1 |
|
~%
Methyl 6-bromoq... CAS#:623583-88-0 |
| Literature: MERCK SHARP and DOHME CORP.; LIN, Linus; SOLL, Richard; DONG, Jingchao; WU, Hao; SUZUKI, Takao; HU, Bin; LIU, Dejun; HAO, Jinglai; XU, Ming Patent: WO2011/127643 A1, 2011 ; WO 2011/127643 A1 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Quinolinecarboxylic acid, 6-bromo-, methyl ester |
| methyl 6-bromoquinoline-2-carboxylate |
| Methyl 6-bromo-2-quinolinecarboxylate |