1-(1-methyl-2-phenylindol-3-yl)ethanone structure
|
Common Name | 1-(1-methyl-2-phenylindol-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 62367-64-0 | Molecular Weight | 249.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1-methyl-2-phenylindol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO |
|---|---|
| Molecular Weight | 249.30700 |
| Exact Mass | 249.11500 |
| PSA | 22.00000 |
| LogP | 4.04790 |
| InChIKey | IKIQUACDGVADHX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(-c2ccccc2)n(C)c2ccccc12 |
|
~92%
1-(1-methyl-2-p... CAS#:62367-64-0 |
| Literature: Colonna, Martino; Greci, Lucedio; Poloni, Marino Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1981 , p. 628 - 632 |
| N-methyl-3-acetyl-2-phenylindole |
| 3-acetyl-1-methyl-2-phenylindole |
| 1-Methyl-2-phenyl-3-acetylindol |