2-Ethyl-6-hydroxy-5-nitro-4(3H)-pyrimidinone structure
|
Common Name | 2-Ethyl-6-hydroxy-5-nitro-4(3H)-pyrimidinone | ||
|---|---|---|---|---|
| CAS Number | 6237-99-6 | Molecular Weight | 185.137 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 294.2ºC at 760 mmHg | |
| Molecular Formula | C6H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.7ºC | |
| Name | 2-Ethyl-6-hydroxy-5-nitropyrimidin-4(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 294.2ºC at 760 mmHg |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.137 |
| Flash Point | 131.7ºC |
| Exact Mass | 185.043655 |
| PSA | 111.80000 |
| LogP | -1.71 |
| Index of Refraction | 1.674 |
| InChIKey | XSQADURXUUGZPI-UHFFFAOYSA-N |
| SMILES | CCc1nc(O)c([N+](=O)[O-])c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-ethyl-4-hydroxy-5-nitro-1H-pyrimidin-6-one |
| 4(3H)-Pyrimidinone, 2-ethyl-6-hydroxy-5-nitro- |
| 2-Ethyl-6-hydroxy-5-nitro-4(3H)-pyrimidinone |