Benzenesulfonyl chloride, 4-(acetylamino)-2-methyl- (9CI)
Modify Date: 2025-08-25 13:24:15
Benzenesulfonyl chloride, 4-(acetylamino)-2-methyl- (9CI) structure
|
Common Name | Benzenesulfonyl chloride, 4-(acetylamino)-2-methyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 62374-67-8 | Molecular Weight | 247.69900 | |
| Density | 1.411 g/cm3 | Boiling Point | 422.4ºC at 760 mmHg | |
| Molecular Formula | C9H10ClNO3S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 209.3ºC | |
| Name | 4-Acetamido-2-methylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411 g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760 mmHg |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.69900 |
| Flash Point | 209.3ºC |
| Exact Mass | 247.00700 |
| PSA | 75.11000 |
| LogP | 3.61120 |
| Index of Refraction | 1.575 |
| InChIKey | CQMOYSYLLYARBD-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Cl)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-acetylamino-toluene-2-sulfonyl chloride |
| 4-Acetylamino-2-methylbenzolsulphonylchlorid |
| Benzenesulfonyl chloride,4-(acetylamino)-2-methyl |
| 4-acetylamino-2-methyl-benzenesulfonyl chloride |
| 5-Acetamino-toluol-sulfonylchlorid-(2) |
| 4-Acetylamino-2-methyl-benzenesulphonic acid chloride |
| 5-Acetylamino-toluol-2-sulfonylchlorid |
| 4-acetamino-2-methyl-benzenesulfonyl chloride |