3-[(4-nitrophenyl)methoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one structure
|
Common Name | 3-[(4-nitrophenyl)methoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one | ||
|---|---|---|---|---|
| CAS Number | 6238-20-6 | Molecular Weight | 351.35300 | |
| Density | 1.37g/cm3 | Boiling Point | 588.1ºC at 760 mmHg | |
| Molecular Formula | C20H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.2ºC | |
| Name | 3-[(4-nitrophenyl)methoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 588.1ºC at 760 mmHg |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.35300 |
| Flash Point | 254.2ºC |
| Exact Mass | 351.11100 |
| PSA | 85.26000 |
| LogP | 4.68220 |
| Index of Refraction | 1.65 |
| InChIKey | AGYDNJPPEFCTLE-UHFFFAOYSA-N |
| SMILES | O=c1oc2cc(OCc3ccc([N+](=O)[O-])cc3)ccc2c2c1CCCC2 |
|
~99%
3-[(4-nitrophen... CAS#:6238-20-6 |
| Literature: Abdur-Rashid, Kamaluddin; Guo, Rongwei; Lough, Alan J.; Morris, Robert H.; Song, Datong Advanced Synthesis and Catalysis, 2005 , vol. 347, # 4 p. 571 - 579 |
|
~29%
3-[(4-nitrophen... CAS#:6238-20-6 |
| Literature: JANSSEN PHARMACEUTICA, N.V. Patent: WO2004/35574 A2, 2004 ; Location in patent: Page 18-19 ; WO 2004/035574 A2 |
| 3-Phenylaminochinuclidin |
| 3-Anilino-chinuclidin |