methyl (Z)-2-hydroxy-4-oxo-4-thiophen-2-ylbut-2-enoate structure
|
Common Name | methyl (Z)-2-hydroxy-4-oxo-4-thiophen-2-ylbut-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 6239-07-2 | Molecular Weight | 212.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl (Z)-2-hydroxy-4-oxo-4-thiophen-2-ylbut-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8O4S |
|---|---|
| Molecular Weight | 212.22200 |
| Exact Mass | 212.01400 |
| PSA | 91.84000 |
| LogP | 1.54570 |
| InChIKey | TZNHHDJRXUBHRB-ALCCZGGFSA-N |
| SMILES | COC(=O)C(O)=CC(=O)c1cccs1 |
|
~%
methyl (Z)-2-hy... CAS#:6239-07-2 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |
| tos-bb-1268 |