2-[4-chloro-2-[(4-chlorobenzoyl)amino]phenoxy]acetic acid structure
|
Common Name | 2-[4-chloro-2-[(4-chlorobenzoyl)amino]phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6239-10-7 | Molecular Weight | 340.15800 | |
| Density | 1.496g/cm3 | Boiling Point | 444ºC at 760 mmHg | |
| Molecular Formula | C15H11Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | 2-[4-chloro-2-[(4-chlorobenzoyl)amino]phenoxy]acetic acid |
|---|
| Density | 1.496g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760 mmHg |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.15800 |
| Flash Point | 222.3ºC |
| Exact Mass | 339.00700 |
| PSA | 75.63000 |
| LogP | 3.78210 |
| Index of Refraction | 1.655 |
| InChIKey | AXOCEAYBOGXTBZ-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(Cl)cc1NC(=O)c1ccc(Cl)cc1 |
|
~%
2-[4-chloro-2-[... CAS#:6239-10-7 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |