2-Formyl-7-chloroimidazo[2,1-b]benzothiazole
Modify Date: 2026-07-06 14:41:05
![2-Formyl-7-chloroimidazo[2,1-b]benzothiazole Structure](https://www.chemsrc.com/extcaspic/409/623906-25-2.png)
2-Formyl-7-chloroimidazo[2,1-b]benzothiazole structure
|
Common Name | 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 623906-25-2 | Molecular Weight | 236.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H5ClN2OS |
|---|---|
| Molecular Weight | 236.68 |
| InChIKey | ZGKMEGHDDKHEKQ-UHFFFAOYSA-N |
| SMILES | O=Cc1cn2c(n1)sc1cc(Cl)ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole? |
| A: Molecular formula of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole is C10H5ClN2OS. |
| Q: What is the CAS number of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole? |
| A: CAS number of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole is 623906-25-2. |
| Q: What is the SMILES notation of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole? |
| A: SMILES notation of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole is O=Cc1cn2c(n1)sc1cc(Cl)ccc12. |
| Q: What is the Chinese name of 623906-25-2? |
| A: Chinese name of 623906-25-2 is 623906-25-2. |
| Q: What is the InChIKey of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole? |
| A: InChIKey of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole is ZGKMEGHDDKHEKQ-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole? |
| A: The English name of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole is 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole. |
| Q: What is the molecular weight of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole? |
| A: Molecular weight of 2-Formyl-7-chloroimidazo[2,1-b]benzothiazole is 236.68. |