α-Oxo-1,3-benzodioxole-5-acetic Acid
α-Oxo-1,3-benzodioxole-5-acetic Acid structure
|
Common Name | α-Oxo-1,3-benzodioxole-5-acetic Acid | ||
|---|---|---|---|---|
| CAS Number | 62396-98-9 | Molecular Weight | 194.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzo[1,3]dioxol-5-yl-oxo-acetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6O5 |
|---|---|
| Molecular Weight | 194.14100 |
| Exact Mass | 194.02200 |
| PSA | 72.83000 |
| LogP | 0.68260 |
| InChIKey | VIIPQXJHKXQJKY-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)c1ccc2c(c1)OCO2 |
| Storage condition | 2-8°C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:120-57-0
CAS#:2861-28-1
CAS#:4421-09-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| α-Oxo-1,3-benzodioxole-5-acetic Acid |
| benzo[1,3]dioxol-5-yl-glyoxylic acid |
| Benzo[1,3]dioxol-5-yl-glyoxylsaeure |
| Alpha-Oxo-1,3-benzodioxole-5-acetic Acid |
| α-Oxo-1,3-benzodioxole-5-acetic Acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: Polar surface area (PSA) of benzo[1,3]dioxol-5-yl-oxo-acetic acid is 72.83000. |
| Q: What is the SMILES notation of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: SMILES notation of benzo[1,3]dioxol-5-yl-oxo-acetic acid is O=C(O)C(=O)c1ccc2c(c1)OCO2. |
| Q: What is the CAS number of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: CAS number of benzo[1,3]dioxol-5-yl-oxo-acetic acid is 62396-98-9. |
| Q: What is the molecular weight of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: Molecular weight of benzo[1,3]dioxol-5-yl-oxo-acetic acid is 194.14100. |
| Q: What English synonyms does benzo[1,3]dioxol-5-yl-oxo-acetic acid have? |
| A: English synonyms of benzo[1,3]dioxol-5-yl-oxo-acetic acid: α-Oxo-1,3-benzodioxole-5-acetic Acid, benzo[1,3]dioxol-5-yl-glyoxylic acid, Benzo[1,3]dioxol-5-yl-glyoxylsaeure, Alpha-Oxo-1,3-benzodioxole-5-acetic Acid, α-Oxo-1,3-benzodioxole-5-acetic Acid. |
| Q: What is the English name of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: The English name of benzo[1,3]dioxol-5-yl-oxo-acetic acid is benzo[1,3]dioxol-5-yl-oxo-acetic acid. |
| Q: What are the downstream products of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: Related downstream products(CAS) of benzo[1,3]dioxol-5-yl-oxo-acetic acid: 120-57-0;2861-28-1;4421-09-4. |
| Q: What is the InChIKey of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: InChIKey of benzo[1,3]dioxol-5-yl-oxo-acetic acid is VIIPQXJHKXQJKY-UHFFFAOYSA-N. |
| Q: What are the storage conditions for benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: Storage conditions for benzo[1,3]dioxol-5-yl-oxo-acetic acid: 2-8°C. |
| Q: What is the LogP of benzo[1,3]dioxol-5-yl-oxo-acetic acid? |
| A: LogP of benzo[1,3]dioxol-5-yl-oxo-acetic acid is 0.68260. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |