Isobenzofuran,1,3-bis(4-chlorophenyl)-5,6-dimethyl- structure
|
Common Name | Isobenzofuran,1,3-bis(4-chlorophenyl)-5,6-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 62423-10-3 | Molecular Weight | 367.26800 | |
| Density | 1.251g/cm3 | Boiling Point | 512.8ºC at 760 mmHg | |
| Molecular Formula | C22H16Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264ºC | |
| Name | 1,3-bis(4-chlorophenyl)-5,6-dimethyl-2-benzofuran |
|---|
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 512.8ºC at 760 mmHg |
| Molecular Formula | C22H16Cl2O |
| Molecular Weight | 367.26800 |
| Flash Point | 264ºC |
| Exact Mass | 366.05800 |
| PSA | 13.14000 |
| LogP | 7.69040 |
| Index of Refraction | 1.634 |
| InChIKey | UGQCJHQQMZPQLQ-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(-c3ccc(Cl)cc3)oc(-c3ccc(Cl)cc3)c2cc1C |
|
~%
Isobenzofuran,1... CAS#:62423-10-3 |
| Literature: Adams; Wearn Journal of the American Chemical Society, 1940 , vol. 62, p. 1233,1235 |
|
~%
Isobenzofuran,1... CAS#:62423-10-3 |
| Literature: Adams; Wearn Journal of the American Chemical Society, 1940 , vol. 62, p. 1233,1235 |
|
~%
Isobenzofuran,1... CAS#:62423-10-3 |
| Literature: Adams; Wearn Journal of the American Chemical Society, 1940 , vol. 62, p. 1233,1235 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |