4-(2-chloro-5-fluorophenyl)-N-phenyl-1,3-thiazol-2-amine structure
|
Common Name | 4-(2-chloro-5-fluorophenyl)-N-phenyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 62433-39-0 | Molecular Weight | 304.77000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10ClFN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-chloro-5-fluorophenyl)-N-phenyl-1,3-thiazol-2-amine |
|---|
| Molecular Formula | C15H10ClFN2S |
|---|---|
| Molecular Weight | 304.77000 |
| Exact Mass | 304.02400 |
| PSA | 56.39000 |
| LogP | 4.76810 |
| InChIKey | DLJKSLAWQZFBPN-UHFFFAOYSA-N |
| SMILES | Fc1ccc(Cl)c(-c2csc(Nc3ccccc3)n2)c1 |
|
~%
4-(2-chloro-5-f... CAS#:62433-39-0 |
| Literature: Srivastava; Bahel Journal of the Indian Chemical Society, 1976 , vol. 53, # 8 p. 841 - 845 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |