4-(5-fluoro-2-methoxyphenyl)-N-(2-methoxyphenyl)-1,3-thiazol-2-amine structure
|
Common Name | 4-(5-fluoro-2-methoxyphenyl)-N-(2-methoxyphenyl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 62433-45-8 | Molecular Weight | 330.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15FN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(5-fluoro-2-methoxyphenyl)-N-(2-methoxyphenyl)-1,3-thiazol-2-amine |
|---|
| Molecular Formula | C17H15FN2O2S |
|---|---|
| Molecular Weight | 330.37700 |
| Exact Mass | 330.08400 |
| PSA | 74.85000 |
| LogP | 4.13190 |
| InChIKey | KGUBPVPNYJYRLB-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Nc1nc(-c2cc(F)ccc2OC)cs1 |
|
~%
4-(5-fluoro-2-m... CAS#:62433-45-8 |
| Literature: Srivastava; Bahel Journal of the Indian Chemical Society, 1976 , vol. 53, # 8 p. 841 - 845 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |