1,3-dimethyl-5,6-diphenyl-1,3,5-triazinane-2,4-dione structure
|
Common Name | 1,3-dimethyl-5,6-diphenyl-1,3,5-triazinane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 62442-16-4 | Molecular Weight | 295.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dimethyl-5,6-diphenyl-1,3,5-triazinane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17N3O2 |
|---|---|
| Molecular Weight | 295.33600 |
| Exact Mass | 295.13200 |
| PSA | 43.86000 |
| LogP | 3.24980 |
| InChIKey | BEFMCRBWZKHPFQ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C)C(c2ccccc2)N(c2ccccc2)C1=O |
|
~%
1,3-dimethyl-5,... CAS#:62442-16-4 |
| Literature: Cremlyn, Richard J.; Ellam, Richard M.; Farouk, Sultan Phosphorus, Sulfur and Silicon and the Related Elements, 2003 , vol. 178, # 9 p. 1931 - 1941 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,5-dimethyl-1,6-diphenylhexahydro-s-triazine-2,4-dione |