3,7-Di(2-thienyl)tetrahydro-1H,5H-(1,2,4)triazolo(1,2-a)(1,2,4)triazole-1,5-dione structure
|
Common Name | 3,7-Di(2-thienyl)tetrahydro-1H,5H-(1,2,4)triazolo(1,2-a)(1,2,4)triazole-1,5-dione | ||
|---|---|---|---|---|
| CAS Number | 62442-26-6 | Molecular Weight | 306.36300 | |
| Density | 1.68g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dithiophen-2-yl-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.36300 |
| Exact Mass | 306.02500 |
| PSA | 121.16000 |
| LogP | 3.00580 |
| Index of Refraction | 1.793 |
| InChIKey | LTJCUQVZDYZPDX-UHFFFAOYSA-N |
| SMILES | O=C1NC(c2cccs2)N2C(=O)NC(c3cccs3)N12 |
|
~%
3,7-Di(2-thieny... CAS#:62442-26-6 |
| Literature: Suschitzky,H. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 47 - 52 |
|
~%
3,7-Di(2-thieny... CAS#:62442-26-6 |
| Literature: Suschitzky,H. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 47 - 52 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,7-di-thiophen-2-yl-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-1,5-dione |
| 3,7-Di(2-thienyl)tetrahydro-1H,5H-[1,2,4]triazolo[1,2-a][1,2,4]triazole-1,5-dione |