1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione
1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione structure
|
Common Name | 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 62448-61-7 | Molecular Weight | 331.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H21NO2 |
|---|---|
| Molecular Weight | 331.40800 |
| Exact Mass | 331.15700 |
| PSA | 37.38000 |
| LogP | 4.23680 |
| InChIKey | GRNPKHZKMCIRIP-UHFFFAOYSA-N |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1C1CCCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3-diphenyl-N-cyclohexylmaleimide |
| 1H-Pyrrole-2,5-dione,1-cyclohexyl-3,4-diphenyl |
| 1,2-Diphenylmaleyl-N-cyclohexylimid |
| 1-cyclohexyl-3,4-diphenyl-1H-pyrrole-2,5-dione |
| 1-cyclohexyl-3,4-diphenyl-pyrrole-2,5-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: CAS number of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is 62448-61-7. |
| Q: What are the upstream materials of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: Related upstream materials(CAS) of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione: 201230-82-2;108-91-8;501-65-5;98-80-6;24564-83-8;1228144-40-8;1631-25-0. |
| Q: What is the LogP of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: LogP of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is 4.23680. |
| Q: What is the molecular weight of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: Molecular weight of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is 331.40800. |
| Q: What is the polar surface area (PSA) of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: Polar surface area (PSA) of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is 37.38000. |
| Q: What is the InChIKey of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: InChIKey of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is GRNPKHZKMCIRIP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: SMILES notation of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1C1CCCCC1. |
| Q: What is the Chinese name of 62448-61-7? |
| A: Chinese name of 62448-61-7 is 62448-61-7. |
| Q: What English synonyms does 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione have? |
| A: English synonyms of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione: 2,3-diphenyl-N-cyclohexylmaleimide, 1H-Pyrrole-2,5-dione,1-cyclohexyl-3,4-diphenyl, 1,2-Diphenylmaleyl-N-cyclohexylimid, 1-cyclohexyl-3,4-diphenyl-1H-pyrrole-2,5-dione, 1-cyclohexyl-3,4-diphenyl-pyrrole-2,5-dione. |
| Q: What is the English name of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione? |
| A: The English name of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione. |