5-bromo-2-propylbenzo[a]anthracene-7,12-dione structure
|
Common Name | 5-bromo-2-propylbenzo[a]anthracene-7,12-dione | ||
|---|---|---|---|---|
| CAS Number | 62452-71-5 | Molecular Weight | 379.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-2-propylbenzo[a]anthracene-7,12-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H15BrO2 |
|---|---|
| Molecular Weight | 379.24700 |
| Exact Mass | 378.02600 |
| PSA | 34.14000 |
| LogP | 5.33020 |
| InChIKey | ORTULDDGOPLEKH-UHFFFAOYSA-N |
| SMILES | CCCc1ccc2c(Br)cc3c(c2c1)C(=O)c1ccccc1C3=O |
|
~%
5-bromo-2-propy... CAS#:62452-71-5 |
| Literature: Otsuki,T. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3713 - 3714 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Brom-2-propylbenz<a>anthracen-7,12-dion |